C9H14N2O — CID 123444035
(6E)-6-ethylidene-2,5-dimethyl-2,3-dihydro-1H-1,4-diazepin-7-one (PubChem CID 123444035) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (6E)-6-ethylidene-2,5-dimethyl-2,3-dihydro-1H-1,4-diazepin-7-one.
| Compound Name | (6E)-6-ethylidene-2,5-dimethyl-2,3-dihydro-1H-1,4-diazepin-7-one |
|---|---|
| PubChem CID | 123444035 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (6E)-6-ethylidene-2,5-dimethyl-2,3-dihydro-1H-1,4-diazepin-7-one |
| SMILES | C/C=C1/C(=O)NC(C)CN=C1C |
| InChI | InChI=1S/C9H14N2O/c1-4-8-7(3)10-5-6(2)11-9(8)12/h4,6H,5H2,1-3H3,(H,11,12)/b8-4+ |
| InChIKey | JEMJLBQIMVMZCD-XBXARRHUSA-N |
| XLogP | 0.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|