C28H33ClF3N5O4 — CID 123444250
N-[[4-chloro-3-[[5-(2-methoxyethoxy)-6-[4-[4-(trifluoromethyl)cyclohexyl]butanoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]phenyl]methyl]formamide (PubChem CID 123444250) has the molecular formula C28H33ClF3N5O4 and a molecular weight of 596.05 g/mol. Its IUPAC name is N-[[4-chloro-3-[[5-(2-methoxyethoxy)-6-[4-[4-(trifluoromethyl)cyclohexyl]butanoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]phenyl]methyl]formamide.
| Compound Name | N-[[4-chloro-3-[[5-(2-methoxyethoxy)-6-[4-[4-(trifluoromethyl)cyclohexyl]butanoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 123444250 |
| Molecular Formula | C28H33ClF3N5O4 |
| Molecular Weight | 596.05 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | N-[[4-chloro-3-[[5-(2-methoxyethoxy)-6-[4-[4-(trifluoromethyl)cyclohexyl]butanoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]phenyl]methyl]formamide |
| SMILES | COCCOc1nc2nc(Nc3cc(CNC=O)ccc3Cl)[nH]c2cc1C(=O)CCCC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H33ClF3N5O4/c1-40-11-12-41-26-20(24(39)4-2-3-17-5-8-19(9-6-17)28(30,31)32)14-23-25(36-26)37-27(35-23)34-22-13-18(15-33-16-38)7-10-21(22)29/h7,10,13-14,16-17,19H,2-6,8-9,11-12,15H2,1H3,(H,33,38)(H2,34,35,36,37) |
| InChIKey | JPYQIMINVJTSFE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.05 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|