C24H42O2 — CID 123444498
1-[1-(2-cyclohexylethoxy)ethoxy]-3-(2,2,4-trimethylpentan-3-yl)cyclohexa-1,3-diene (PubChem CID 123444498) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)ethoxy]-3-(2,2,4-trimethylpentan-3-yl)cyclohexa-1,3-diene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-3-(2,2,4-trimethylpentan-3-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123444498 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-3-(2,2,4-trimethylpentan-3-yl)cyclohexa-1,3-diene |
| SMILES | CC(OCCC1CCCCC1)OC1=CC(C(C(C)C)C(C)(C)C)=CCC1 |
| InChI | InChI=1S/C24H42O2/c1-18(2)23(24(4,5)6)21-13-10-14-22(17-21)26-19(3)25-16-15-20-11-8-7-9-12-20/h13,17-20,23H,7-12,14-16H2,1-6H3 |
| InChIKey | JIYPABZBFBUIRQ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|