C15H17F6N3O — CID 123444664
1-(5-aminocyclohex-2-en-1-yl)-3-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea (PubChem CID 123444664) has the molecular formula C15H17F6N3O and a molecular weight of 369.31 g/mol. Its IUPAC name is 1-(5-aminocyclohex-2-en-1-yl)-3-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea.
| Compound Name | 1-(5-aminocyclohex-2-en-1-yl)-3-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea |
|---|---|
| PubChem CID | 123444664 |
| Molecular Formula | C15H17F6N3O |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(5-aminocyclohex-2-en-1-yl)-3-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea |
| SMILES | NC1CC=CC(NC(=O)NC2C=C(C(F)(F)F)C=C(C(F)(F)F)C2)C1 |
| InChI | InChI=1S/C15H17F6N3O/c16-14(17,18)8-4-9(15(19,20)21)6-12(5-8)24-13(25)23-11-3-1-2-10(22)7-11/h1,3-5,10-12H,2,6-7,22H2,(H2,23,24,25) |
| InChIKey | HFQYQXNCPHQPMH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|