C27H27ClN2O2 — CID 123444939
2-chloro-6-(4-methoxycyclohexa-2,4-dien-1-yl)-4-(2-methyl-6-phenoxyhepta-3,5-dien-3-yl)pyridine-3-carbonitrile (PubChem CID 123444939) has the molecular formula C27H27ClN2O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-chloro-6-(4-methoxycyclohexa-2,4-dien-1-yl)-4-(2-methyl-6-phenoxyhepta-3,5-dien-3-yl)pyridine-3-carbonitrile.
| Compound Name | 2-chloro-6-(4-methoxycyclohexa-2,4-dien-1-yl)-4-(2-methyl-6-phenoxyhepta-3,5-dien-3-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123444939 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-chloro-6-(4-methoxycyclohexa-2,4-dien-1-yl)-4-(2-methyl-6-phenoxyhepta-3,5-dien-3-yl)pyridine-3-carbonitrile |
| SMILES | COC1=CCC(c2cc(C(=CC=C(C)Oc3ccccc3)C(C)C)c(C#N)c(Cl)n2)C=C1 |
| InChI | InChI=1S/C27H27ClN2O2/c1-18(2)23(15-10-19(3)32-22-8-6-5-7-9-22)24-16-26(30-27(28)25(24)17-29)20-11-13-21(31-4)14-12-20/h5-11,13-16,18,20H,12H2,1-4H3 |
| InChIKey | AJHRINNBOVYIJD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|