C29H33ClFNO5 — CID 123445415
6-(3-chlorophenyl)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-2,9,13-trimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 123445415) has the molecular formula C29H33ClFNO5 and a molecular weight of 530.04 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-2,9,13-trimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | 6-(3-chlorophenyl)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-2,9,13-trimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 123445415 |
| Molecular Formula | C29H33ClFNO5 |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 6-(3-chlorophenyl)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-2,9,13-trimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC12C=CC(=O)C=C1C(F)CC1C2C(O)CC2(C)C1(C)CC1CN(c3cccc(Cl)c3)OC12C(=O)CO |
| InChI | InChI=1S/C29H33ClFNO5/c1-26-8-7-19(34)10-20(26)22(31)11-21-25(26)23(35)13-28(3)27(21,2)12-16-14-32(18-6-4-5-17(30)9-18)37-29(16,28)24(36)15-33/h4-10,16,21-23,25,33,35H,11-15H2,1-3H3 |
| InChIKey | DWISTQJHYBELEO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |