C18H19ClN4S — CID 123445436
3-(3-chlorophenyl)-N-(thian-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 123445436) has the molecular formula C18H19ClN4S and a molecular weight of 358.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(thian-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-(3-chlorophenyl)-N-(thian-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 123445436 |
| Molecular Formula | C18H19ClN4S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(thian-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | Clc1cccc(-c2cnc3ccc(NCC4CCSCC4)nn23)c1 |
| InChI | InChI=1S/C18H19ClN4S/c19-15-3-1-2-14(10-15)16-12-21-18-5-4-17(22-23(16)18)20-11-13-6-8-24-9-7-13/h1-5,10,12-13H,6-9,11H2,(H,20,22) |
| InChIKey | UVDGPKCLUOESCP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |