C19H24F2N2 — CID 123445499
(4Z,8Z)-11,11-difluoro-N-(2-iminopropyl)-3,6,7,10-tetramethylidenedodeca-4,8-dien-2-imine (PubChem CID 123445499) has the molecular formula C19H24F2N2 and a molecular weight of 318.41 g/mol. Its IUPAC name is (4Z,8Z)-11,11-difluoro-N-(2-iminopropyl)-3,6,7,10-tetramethylidenedodeca-4,8-dien-2-imine.
| Compound Name | (4Z,8Z)-11,11-difluoro-N-(2-iminopropyl)-3,6,7,10-tetramethylidenedodeca-4,8-dien-2-imine |
|---|---|
| PubChem CID | 123445499 |
| Molecular Formula | C19H24F2N2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (4Z,8Z)-11,11-difluoro-N-(2-iminopropyl)-3,6,7,10-tetramethylidenedodeca-4,8-dien-2-imine |
| SMILES | [H]/N=C(\C)C/N=C(\C)C(=C)/C=C\C(=C)C(=C)/C=C\C(=C)C(C)(F)F |
| InChI | InChI=1S/C19H24F2N2/c1-13(14(2)10-11-16(4)19(7,20)21)8-9-15(3)18(6)23-12-17(5)22/h8-11,22H,1-4,12H2,5-7H3/b9-8-,11-10-,22-17+,23-18+ |
| InChIKey | AIRKRCRGHAUTNG-DGADCRGLSA-N |
| XLogP | 5.48 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|