C20H36N2O2 — CID 123445569
ethyl 2-[5-(2-ethylhexylimino)-3,3-dimethylcyclohexyl]-2-iminoacetate (PubChem CID 123445569) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is ethyl 2-[5-(2-ethylhexylimino)-3,3-dimethylcyclohexyl]-2-iminoacetate.
| Compound Name | ethyl 2-[5-(2-ethylhexylimino)-3,3-dimethylcyclohexyl]-2-iminoacetate |
|---|---|
| PubChem CID | 123445569 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | ethyl 2-[5-(2-ethylhexylimino)-3,3-dimethylcyclohexyl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)C1C/C(=N/CC(CC)CCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C20H36N2O2/c1-6-9-10-15(7-2)14-22-17-11-16(12-20(4,5)13-17)18(21)19(23)24-8-3/h15-16,21H,6-14H2,1-5H3/b21-18-,22-17- |
| InChIKey | MZRSPTBZBNPISA-XGBWRMQCSA-N |
| XLogP | 5.05 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|