C27H28BrFN2O3 — CID 123445874
9-bromo-7-fluoro-6-[(4-methoxyphenyl)methyl]-4-methyl-8-(4-methylpentoxy)benzo[c][2,7]naphthyridin-5-one (PubChem CID 123445874) has the molecular formula C27H28BrFN2O3 and a molecular weight of 527.43 g/mol. Its IUPAC name is 9-bromo-7-fluoro-6-[(4-methoxyphenyl)methyl]-4-methyl-8-(4-methylpentoxy)benzo[c][2,7]naphthyridin-5-one.
| Compound Name | 9-bromo-7-fluoro-6-[(4-methoxyphenyl)methyl]-4-methyl-8-(4-methylpentoxy)benzo[c][2,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 123445874 |
| Molecular Formula | C27H28BrFN2O3 |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 9-bromo-7-fluoro-6-[(4-methoxyphenyl)methyl]-4-methyl-8-(4-methylpentoxy)benzo[c][2,7]naphthyridin-5-one |
| SMILES | COc1ccc(Cn2c(=O)c3c(C)nccc3c3cc(Br)c(OCCCC(C)C)c(F)c32)cc1 |
| InChI | InChI=1S/C27H28BrFN2O3/c1-16(2)6-5-13-34-26-22(28)14-21-20-11-12-30-17(3)23(20)27(32)31(25(21)24(26)29)15-18-7-9-19(33-4)10-8-18/h7-12,14,16H,5-6,13,15H2,1-4H3 |
| InChIKey | MNAFWCMYEXHFLZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|