C7H11NO — CID 123445894
3,4,6-trimethyl-4H-oxazine (PubChem CID 123445894) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,4,6-trimethyl-4H-oxazine.
| Compound Name | 3,4,6-trimethyl-4H-oxazine |
|---|---|
| PubChem CID | 123445894 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3,4,6-trimethyl-4H-oxazine |
| SMILES | CC1=CC(C)C(C)=NO1 |
| InChI | InChI=1S/C7H11NO/c1-5-4-6(2)9-8-7(5)3/h4-5H,1-3H3 |
| InChIKey | GYJLTLKZCZMFJE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |