C28H29F3O3 — CID 123445955
[3-(trifluoromethyl)phenyl] 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 123445955) has the molecular formula C28H29F3O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | [3-(trifluoromethyl)phenyl] 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 123445955 |
| Molecular Formula | C28H29F3O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | COc1cc(C)c(C=CC(C)=CC=CC(C)=CC(=O)Oc2cccc(C(F)(F)F)c2)c(C)c1C |
| InChI | InChI=1S/C28H29F3O3/c1-18(13-14-25-20(3)16-26(33-6)22(5)21(25)4)9-7-10-19(2)15-27(32)34-24-12-8-11-23(17-24)28(29,30)31/h7-17H,1-6H3 |
| InChIKey | MAQOSONXDCBTRZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|