C21H22ClF3N3+ — CID 123446241
aminomethylidene-[[4-[3-(3-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-propylazanium (PubChem CID 123446241) has the molecular formula C21H22ClF3N3+ and a molecular weight of 408.88 g/mol. Its IUPAC name is aminomethylidene-[[4-[3-(3-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-propylazanium.
| Compound Name | aminomethylidene-[[4-[3-(3-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-propylazanium |
|---|---|
| PubChem CID | 123446241 |
| Molecular Formula | C21H22ClF3N3+ |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | aminomethylidene-[[4-[3-(3-chlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-propylazanium |
| SMILES | CCC[N+](/C=N/c1ccc(C=CC(c2cccc(Cl)c2)C(F)(F)F)cc1)=C\N |
| InChI | InChI=1S/C21H21ClF3N3/c1-2-12-28(14-26)15-27-19-9-6-16(7-10-19)8-11-20(21(23,24)25)17-4-3-5-18(22)13-17/h3-11,13-15,20,26H,2,12H2,1H3/p+1/b11-8?,27-15+ |
| InChIKey | IIGNBXZIBCCAQU-PVYOVWHQSA-O |
| XLogP | 5.77 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|