C17H27F3N2O3S — CID 123446283
3-(dibutylamino)-5-(2,2,2-trifluoroethoxymethyl)benzenesulfonamide (PubChem CID 123446283) has the molecular formula C17H27F3N2O3S and a molecular weight of 396.48 g/mol. Its IUPAC name is 3-(dibutylamino)-5-(2,2,2-trifluoroethoxymethyl)benzenesulfonamide.
| Compound Name | 3-(dibutylamino)-5-(2,2,2-trifluoroethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 123446283 |
| Molecular Formula | C17H27F3N2O3S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-(dibutylamino)-5-(2,2,2-trifluoroethoxymethyl)benzenesulfonamide |
| SMILES | CCCCN(CCCC)c1cc(COCC(F)(F)F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H27F3N2O3S/c1-3-5-7-22(8-6-4-2)15-9-14(12-25-13-17(18,19)20)10-16(11-15)26(21,23)24/h9-11H,3-8,12-13H2,1-2H3,(H2,21,23,24) |
| InChIKey | OPEOLEVPRYJNNJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |