About 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine
6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine (PubChem CID 123446575) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine.
Molecular Properties
| Compound Name | 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine |
| PubChem CID | 123446575 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine |
| SMILES | CCCNCC1=CCC(N)CO1 |
| InChI | InChI=1S/C9H18N2O/c1-2-5-11-6-9-4-3-8(10)7-12-9/h4,8,11H,2-3,5-7,10H2,1H3 |
| InChIKey | AIUAVHOTFIUEHL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The IUPAC name of 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine (CID 123446575) is 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine.
What is the SMILES notation for 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The canonical SMILES for 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine is CCCNCC1=CCC(N)CO1.
What is the InChIKey of 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The InChIKey is AIUAVHOTFIUEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-2-5-11-6-9-4-3-8(10)7-12-9/h4,8,11H,2-3,5-7,10H2,1H3.
What are the key properties of 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine?
6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine has a molecular weight of 170.26 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(propylaminomethyl)-3,4-dihydro-2H-pyran-3-amine is sourced from PubChem (CID 123446575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).