C22H28FN3OSi — CID 123446689
[(1R,3S,4S)-4-azido-3-fluorocyclohexyl]oxy-tert-butyl-diphenylsilane (PubChem CID 123446689) has the molecular formula C22H28FN3OSi and a molecular weight of 397.57 g/mol. Its IUPAC name is [(1R,3S,4S)-4-azido-3-fluorocyclohexyl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,3S,4S)-4-azido-3-fluorocyclohexyl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 123446689 |
| Molecular Formula | C22H28FN3OSi |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [(1R,3S,4S)-4-azido-3-fluorocyclohexyl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@H](N=[N+]=[N-])[C@@H](F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28FN3OSi/c1-22(2,3)28(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-17-14-15-21(25-26-24)20(23)16-17/h4-13,17,20-21H,14-16H2,1-3H3/t17-,20+,21+/m1/s1 |
| InChIKey | JCSGATADXITGFN-QMMLZNLJSA-N |
| XLogP | 5.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|