C23H44O3S — CID 123446921
S-(2,3-dihydroxypropyl) 2,4,4,7,7,9,9-heptamethyl-2-propyldec-5-enethioate (PubChem CID 123446921) has the molecular formula C23H44O3S and a molecular weight of 400.67 g/mol. Its IUPAC name is S-(2,3-dihydroxypropyl) 2,4,4,7,7,9,9-heptamethyl-2-propyldec-5-enethioate.
| Compound Name | S-(2,3-dihydroxypropyl) 2,4,4,7,7,9,9-heptamethyl-2-propyldec-5-enethioate |
|---|---|
| PubChem CID | 123446921 |
| Molecular Formula | C23H44O3S |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | S-(2,3-dihydroxypropyl) 2,4,4,7,7,9,9-heptamethyl-2-propyldec-5-enethioate |
| SMILES | CCCC(C)(CC(C)(C)C=CC(C)(C)CC(C)(C)C)C(=O)SCC(O)CO |
| InChI | InChI=1S/C23H44O3S/c1-10-11-23(9,19(26)27-15-18(25)14-24)17-22(7,8)13-12-21(5,6)16-20(2,3)4/h12-13,18,24-25H,10-11,14-17H2,1-9H3 |
| InChIKey | ZWJJHDSOLGJIKM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|