About 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate
2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate (PubChem CID 123446942) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate.
Molecular Properties
| Compound Name | 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate |
| PubChem CID | 123446942 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate |
| SMILES | CC1=CC(=O)N(CCOC(=O)N=[N+]=[N-])C1O |
| InChI | InChI=1S/C8H10N4O4/c1-5-4-6(13)12(7(5)14)2-3-16-8(15)10-11-9/h4,7,14H,2-3H2,1H3 |
| InChIKey | ICGYFLOIPYCPLB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate?
The IUPAC name of 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate (CID 123446942) is 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate.
What is the SMILES notation for 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate?
The canonical SMILES for 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate is CC1=CC(=O)N(CCOC(=O)N=[N+]=[N-])C1O.
What is the InChIKey of 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate?
The InChIKey is ICGYFLOIPYCPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c1-5-4-6(13)12(7(5)14)2-3-16-8(15)10-11-9/h4,7,14H,2-3H2,1H3.
What are the key properties of 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate?
2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate has a molecular weight of 226.19 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-3-methyl-5-oxo-2H-pyrrol-1-yl)ethyl N-diazocarbamate is sourced from PubChem (CID 123446942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).