C19H21FN4O3 — CID 123447225
methyl 3-amino-4-fluoro-N-(1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carbonyl)pent-2-enimidate (PubChem CID 123447225) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl 3-amino-4-fluoro-N-(1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carbonyl)pent-2-enimidate.
| Compound Name | methyl 3-amino-4-fluoro-N-(1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carbonyl)pent-2-enimidate |
|---|---|
| PubChem CID | 123447225 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl 3-amino-4-fluoro-N-(1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carbonyl)pent-2-enimidate |
| SMILES | CO/C(C=C(N)C(C)F)=N\C(=O)c1ccc2cc3n(c2c1)CCCNC3=O |
| InChI | InChI=1S/C19H21FN4O3/c1-11(20)14(21)10-17(27-2)23-18(25)13-5-4-12-8-16-19(26)22-6-3-7-24(16)15(12)9-13/h4-5,8-11H,3,6-7,21H2,1-2H3,(H,22,26)/b14-10?,23-17- |
| InChIKey | GYKFTNKHWRSMQG-NGIRCKCNSA-N |
| XLogP | 2.16 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|