C20H24F3N3O2S — CID 123447459
N-methyl-1-(2-methylphenyl)imino-1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]propan-2-amine (PubChem CID 123447459) has the molecular formula C20H24F3N3O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-methyl-1-(2-methylphenyl)imino-1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]propan-2-amine.
| Compound Name | N-methyl-1-(2-methylphenyl)imino-1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]propan-2-amine |
|---|---|
| PubChem CID | 123447459 |
| Molecular Formula | C20H24F3N3O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-methyl-1-(2-methylphenyl)imino-1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]propan-2-amine |
| SMILES | CNC(C)/C(=N\c1ccccc1C)S(=O)Cc1nccc(OCC(F)(F)F)c1C |
| InChI | InChI=1S/C20H24F3N3O2S/c1-13-7-5-6-8-16(13)26-19(15(3)24-4)29(27)11-17-14(2)18(9-10-25-17)28-12-20(21,22)23/h5-10,15,24H,11-12H2,1-4H3/b26-19+ |
| InChIKey | YSMSFCSRSFDFKX-LGUFXXKBSA-N |
| XLogP | 4.23 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|