C13H17NO4 — CID 123447677
2-(1,3-dihydroxy-4,5,6,7-tetrahydro-2H-isoindol-4-yl)ethyl prop-2-enoate (PubChem CID 123447677) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(1,3-dihydroxy-4,5,6,7-tetrahydro-2H-isoindol-4-yl)ethyl prop-2-enoate.
| Compound Name | 2-(1,3-dihydroxy-4,5,6,7-tetrahydro-2H-isoindol-4-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 123447677 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(1,3-dihydroxy-4,5,6,7-tetrahydro-2H-isoindol-4-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1CCCc2c(O)[nH]c(O)c21 |
| InChI | InChI=1S/C13H17NO4/c1-2-10(15)18-7-6-8-4-3-5-9-11(8)13(17)14-12(9)16/h2,8,14,16-17H,1,3-7H2 |
| InChIKey | TWWXZQLQGWJPKJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|