C14H17N2+ — CID 123447916
2-[(1-methylidene-3,4-dihydro-2H-pyridin-1-ium-6-yl)methyl]-1-azacycloocta-1,3,4,5-tetraene (PubChem CID 123447916) has the molecular formula C14H17N2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-[(1-methylidene-3,4-dihydro-2H-pyridin-1-ium-6-yl)methyl]-1-azacycloocta-1,3,4,5-tetraene.
| Compound Name | 2-[(1-methylidene-3,4-dihydro-2H-pyridin-1-ium-6-yl)methyl]-1-azacycloocta-1,3,4,5-tetraene |
|---|---|
| PubChem CID | 123447916 |
| Molecular Formula | C14H17N2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-[(1-methylidene-3,4-dihydro-2H-pyridin-1-ium-6-yl)methyl]-1-azacycloocta-1,3,4,5-tetraene |
| SMILES | C=[N+]1CCCC=C1C/C1=N/CCC=C=C=C1 |
| InChI | InChI=1S/C14H17N2/c1-16-11-7-5-9-14(16)12-13-8-4-2-3-6-10-15-13/h3,8-9H,1,5-7,10-12H2/q+1/b8-3-,15-13+ |
| InChIKey | LXOWXOZORTWTML-WYGPHOGPSA-N |
| XLogP | 2.48 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|