C17H12Cl2FN5OS — CID 123448232
(2,4-dichloro-3-fluorophenyl)-[5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone (PubChem CID 123448232) has the molecular formula C17H12Cl2FN5OS and a molecular weight of 424.29 g/mol. Its IUPAC name is (2,4-dichloro-3-fluorophenyl)-[5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone.
| Compound Name | (2,4-dichloro-3-fluorophenyl)-[5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
|---|---|
| PubChem CID | 123448232 |
| Molecular Formula | C17H12Cl2FN5OS |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2,4-dichloro-3-fluorophenyl)-[5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(F)c1Cl)N1C2CCC1c1nnc(-c3cscn3)n1C2 |
| InChI | InChI=1S/C17H12Cl2FN5OS/c18-10-3-2-9(13(19)14(10)20)17(26)25-8-1-4-12(25)16-23-22-15(24(16)5-8)11-6-27-7-21-11/h2-3,6-8,12H,1,4-5H2 |
| InChIKey | LEXDKUWFGJVJTC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|