C19H42O2Si2 — CID 123448234
dimethyl-(2,3,5-trimethyl-4-methylideneheptan-2-yl)oxy-(2-trimethylsilyloxypropan-2-yl)silane (PubChem CID 123448234) has the molecular formula C19H42O2Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is dimethyl-(2,3,5-trimethyl-4-methylideneheptan-2-yl)oxy-(2-trimethylsilyloxypropan-2-yl)silane.
| Compound Name | dimethyl-(2,3,5-trimethyl-4-methylideneheptan-2-yl)oxy-(2-trimethylsilyloxypropan-2-yl)silane |
|---|---|
| PubChem CID | 123448234 |
| Molecular Formula | C19H42O2Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | dimethyl-(2,3,5-trimethyl-4-methylideneheptan-2-yl)oxy-(2-trimethylsilyloxypropan-2-yl)silane |
| SMILES | C=C(C(C)CC)C(C)C(C)(C)O[Si](C)(C)C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42O2Si2/c1-14-15(2)16(3)17(4)18(5,6)20-23(12,13)19(7,8)21-22(9,10)11/h15,17H,3,14H2,1-2,4-13H3 |
| InChIKey | AWQRDPCRWZDQFT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|