C26H39N2O12P — CID 123448554
(2,5-dihydroxypyrrol-1-yl) 2-[3-methyl-3-[3-methyl-3-[2-[[2-(4-phosphonooxyphenyl)acetyl]amino]ethoxy]butoxy]butoxy]acetate (PubChem CID 123448554) has the molecular formula C26H39N2O12P and a molecular weight of 602.57 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[3-methyl-3-[3-methyl-3-[2-[[2-(4-phosphonooxyphenyl)acetyl]amino]ethoxy]butoxy]butoxy]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[3-methyl-3-[3-methyl-3-[2-[[2-(4-phosphonooxyphenyl)acetyl]amino]ethoxy]butoxy]butoxy]acetate |
|---|---|
| PubChem CID | 123448554 |
| Molecular Formula | C26H39N2O12P |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[3-methyl-3-[3-methyl-3-[2-[[2-(4-phosphonooxyphenyl)acetyl]amino]ethoxy]butoxy]butoxy]acetate |
| SMILES | CC(C)(CCOCC(=O)On1c(O)ccc1O)OCCC(C)(C)OCCNC(=O)Cc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C26H39N2O12P/c1-25(2,11-14-36-18-24(32)39-28-22(30)9-10-23(28)31)37-15-12-26(3,4)38-16-13-27-21(29)17-19-5-7-20(8-6-19)40-41(33,34)35/h5-10,30-31H,11-18H2,1-4H3,(H,27,29)(H2,33,34,35) |
| InChIKey | IPYMOVSTKQRVES-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 195.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|