C10H19NO — CID 123448577
1-(2-methoxyethyl)-4-methyl-2,3,6,7-tetrahydroazepine (PubChem CID 123448577) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-methyl-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(2-methoxyethyl)-4-methyl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 123448577 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(2-methoxyethyl)-4-methyl-2,3,6,7-tetrahydroazepine |
| SMILES | COCCN1CCC=C(C)CC1 |
| InChI | InChI=1S/C10H19NO/c1-10-4-3-6-11(7-5-10)8-9-12-2/h4H,3,5-9H2,1-2H3 |
| InChIKey | NYTJTALKEHRABI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|