C21H21N2O2+ — CID 123448881
8,10,12-trimethyl-11-(4-methylphenoxy)-13-oxa-11-aza-9-azoniatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 123448881) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 8,10,12-trimethyl-11-(4-methylphenoxy)-13-oxa-11-aza-9-azoniatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 8,10,12-trimethyl-11-(4-methylphenoxy)-13-oxa-11-aza-9-azoniatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 123448881 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 8,10,12-trimethyl-11-(4-methylphenoxy)-13-oxa-11-aza-9-azoniatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | Cc1ccc(ON2C3(C)Oc4cccc5ccc(C)[n+](c45)C23C)cc1 |
| InChI | InChI=1S/C21H21N2O2/c1-14-8-12-17(13-9-14)25-23-20(3)21(23,4)24-18-7-5-6-16-11-10-15(2)22(20)19(16)18/h5-13H,1-4H3/q+1 |
| InChIKey | AFUKETLZXMHFAC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|