C25H22F3N5O — CID 123449488
N-methyl-8-[4-[[6-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]butan-2-yl]quinoline-4-carboxamide (PubChem CID 123449488) has the molecular formula C25H22F3N5O and a molecular weight of 465.48 g/mol. Its IUPAC name is N-methyl-8-[4-[[6-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]butan-2-yl]quinoline-4-carboxamide.
| Compound Name | N-methyl-8-[4-[[6-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]butan-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 123449488 |
| Molecular Formula | C25H22F3N5O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-methyl-8-[4-[[6-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]butan-2-yl]quinoline-4-carboxamide |
| SMILES | CNC(=O)c1ccnc2c(C(C)CCNc3cc(-c4cc(F)c(F)c(F)c4)ncn3)cccc12 |
| InChI | InChI=1S/C25H22F3N5O/c1-14(16-4-3-5-17-18(25(34)29-2)7-9-31-24(16)17)6-8-30-22-12-21(32-13-33-22)15-10-19(26)23(28)20(27)11-15/h3-5,7,9-14H,6,8H2,1-2H3,(H,29,34)(H,30,32,33) |
| InChIKey | DUTUDLGFEAHUIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|