3-chlorohex-2-enimidoyl chloride

C6H9Cl2N — CID 123449524

IUPAC3-chlorohex-2-enimidoyl chloride
SMILES[H]/N=C(\Cl)C=C(Cl)CCC
InChIInChI=1S/C6H9Cl2N/c1-2-3-5(7)4-6(8)9/h4,9H,2-3H2,1H3/b5-4?,9-6-
InChIKeyRXOGPAHZRQDEMG-CSZDEEEVSA-N
MW166.05 g/mol
LogP3.13
Rot. Bonds3

About 3-chlorohex-2-enimidoyl chloride

3-chlorohex-2-enimidoyl chloride (PubChem CID 123449524) has the molecular formula C6H9Cl2N and a molecular weight of 166.05 g/mol. Its IUPAC name is 3-chlorohex-2-enimidoyl chloride.

Molecular Properties

Compound Name3-chlorohex-2-enimidoyl chloride
PubChem CID123449524
Molecular FormulaC6H9Cl2N
Molecular Weight166.05 g/mol
Exact Mass165.01
IUPAC Name3-chlorohex-2-enimidoyl chloride
SMILES[H]/N=C(\Cl)C=C(Cl)CCC
InChIInChI=1S/C6H9Cl2N/c1-2-3-5(7)4-6(8)9/h4,9H,2-3H2,1H3/b5-4?,9-6-
InChIKeyRXOGPAHZRQDEMG-CSZDEEEVSA-N
XLogP3.13
TPSA23.85 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.05
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 3-chlorohex-2-enimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chlorohex-2-enimidoyl chloride?
The IUPAC name of 3-chlorohex-2-enimidoyl chloride (CID 123449524) is 3-chlorohex-2-enimidoyl chloride.
What is the SMILES notation for 3-chlorohex-2-enimidoyl chloride?
The canonical SMILES for 3-chlorohex-2-enimidoyl chloride is [H]/N=C(\Cl)C=C(Cl)CCC.
What is the InChIKey of 3-chlorohex-2-enimidoyl chloride?
The InChIKey is RXOGPAHZRQDEMG-CSZDEEEVSA-N. The full InChI is InChI=1S/C6H9Cl2N/c1-2-3-5(7)4-6(8)9/h4,9H,2-3H2,1H3/b5-4?,9-6-.
What are the key properties of 3-chlorohex-2-enimidoyl chloride?
3-chlorohex-2-enimidoyl chloride has a molecular weight of 166.05 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorohex-2-enimidoyl chloride is sourced from PubChem (CID 123449524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).