C27H46N4O2 — CID 123449583
4-methylidene-2-prop-1-enyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)pent-2-enediamide (PubChem CID 123449583) has the molecular formula C27H46N4O2 and a molecular weight of 458.69 g/mol. Its IUPAC name is 4-methylidene-2-prop-1-enyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)pent-2-enediamide.
| Compound Name | 4-methylidene-2-prop-1-enyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)pent-2-enediamide |
|---|---|
| PubChem CID | 123449583 |
| Molecular Formula | C27H46N4O2 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | 4-methylidene-2-prop-1-enyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)pent-2-enediamide |
| SMILES | C=C(C=C(C=CC)C(=O)NC1CC(C)(C)NC(C)(C)C1)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H46N4O2/c1-11-12-19(23(33)29-21-16-26(7,8)31-27(9,10)17-21)13-18(2)22(32)28-20-14-24(3,4)30-25(5,6)15-20/h11-13,20-21,30-31H,2,14-17H2,1,3-10H3,(H,28,32)(H,29,33) |
| InChIKey | SDSBRGQFNAMQMK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|