C31H16N8O9 — CID 123449934
[5-[1-(3-cyanato-5-isocyanato-4-methylphenyl)-3-(3,5-diisocyanato-4-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]-3-isocyanato-2-methylphenyl] cyanate (PubChem CID 123449934) has the molecular formula C31H16N8O9 and a molecular weight of 644.52 g/mol. Its IUPAC name is [5-[1-(3-cyanato-5-isocyanato-4-methylphenyl)-3-(3,5-diisocyanato-4-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]-3-isocyanato-2-methylphenyl] cyanate.
| Compound Name | [5-[1-(3-cyanato-5-isocyanato-4-methylphenyl)-3-(3,5-diisocyanato-4-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]-3-isocyanato-2-methylphenyl] cyanate |
|---|---|
| PubChem CID | 123449934 |
| Molecular Formula | C31H16N8O9 |
| Molecular Weight | 644.52 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | [5-[1-(3-cyanato-5-isocyanato-4-methylphenyl)-3-(3,5-diisocyanato-4-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]-3-isocyanato-2-methylphenyl] cyanate |
| SMILES | Cc1c(N=C=O)cc(-n2c(=O)c(-c3cc(N=C=O)c(C)c(OC#N)c3)c(O)n(-c3cc(N=C=O)c(C)c(OC#N)c3)c2=O)cc1N=C=O |
| InChI | InChI=1S/C31H16N8O9/c1-16-23(35-13-41)6-20(7-24(16)36-14-42)38-29(44)28(19-4-22(34-12-40)17(2)26(5-19)47-10-32)30(45)39(31(38)46)21-8-25(37-15-43)18(3)27(9-21)48-11-33/h4-9,45H,1-3H3 |
| InChIKey | URMJSIAKDGWURU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 247.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|