C38H55ClN4O5Si — CID 123449958
tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloro-3-pyridinyl)-6-[4-[[5-(1-hydroxyethyl)-3-pyridinyl]methyl-methylcarbamoyl]phenyl]hexan-2-yl]carbamate (PubChem CID 123449958) has the molecular formula C38H55ClN4O5Si and a molecular weight of 711.42 g/mol. Its IUPAC name is tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloro-3-pyridinyl)-6-[4-[[5-(1-hydroxyethyl)-3-pyridinyl]methyl-methylcarbamoyl]phenyl]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloro-3-pyridinyl)-6-[4-[[5-(1-hydroxyethyl)-3-pyridinyl]methyl-methylcarbamoyl]phenyl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 123449958 |
| Molecular Formula | C38H55ClN4O5Si |
| Molecular Weight | 711.42 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloro-3-pyridinyl)-6-[4-[[5-(1-hydroxyethyl)-3-pyridinyl]methyl-methylcarbamoyl]phenyl]hexan-2-yl]carbamate |
| SMILES | CC(O)c1cncc(CN(C)C(=O)c2ccc(CCCCC(NC(=O)OC(C)(C)C)C(O[Si](C)(C)C(C)(C)C)c3ccc(Cl)nc3)cc2)c1 |
| InChI | InChI=1S/C38H55ClN4O5Si/c1-26(44)31-21-28(22-40-23-31)25-43(8)35(45)29-17-15-27(16-18-29)13-11-12-14-32(42-36(46)47-37(2,3)4)34(30-19-20-33(39)41-24-30)48-49(9,10)38(5,6)7/h15-24,26,32,34,44H,11-14,25H2,1-10H3,(H,42,46) |
| InChIKey | IFWVODOGLBYLAL-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.42 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|