About 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine
3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine (PubChem CID 123451391) has the molecular formula C12H13ClN2O3
and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine |
| PubChem CID | 123451391 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine |
| SMILES | COc1ccc(OC2=NN=C(Cl)CC2)cc1OC |
| InChI | InChI=1S/C12H13ClN2O3/c1-16-9-4-3-8(7-10(9)17-2)18-12-6-5-11(13)14-15-12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | SIJYJMJIGVIFJP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine?
The IUPAC name of 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine (CID 123451391) is 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine.
What is the SMILES notation for 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine?
The canonical SMILES for 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine is COc1ccc(OC2=NN=C(Cl)CC2)cc1OC.
What is the InChIKey of 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine?
The InChIKey is SIJYJMJIGVIFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O3/c1-16-9-4-3-8(7-10(9)17-2)18-12-6-5-11(13)14-15-12/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine?
3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine has a molecular weight of 268.70 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(3,4-dimethoxyphenoxy)-4,5-dihydropyridazine is sourced from PubChem (CID 123451391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).