C24H28N4O — CID 123451628
N-[2-(2-cyclopropyloxyphenyl)-2-methylbutyl]-6-(6-methyl-3-pyridinyl)pyrimidin-4-amine (PubChem CID 123451628) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[2-(2-cyclopropyloxyphenyl)-2-methylbutyl]-6-(6-methyl-3-pyridinyl)pyrimidin-4-amine.
| Compound Name | N-[2-(2-cyclopropyloxyphenyl)-2-methylbutyl]-6-(6-methyl-3-pyridinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 123451628 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[2-(2-cyclopropyloxyphenyl)-2-methylbutyl]-6-(6-methyl-3-pyridinyl)pyrimidin-4-amine |
| SMILES | CCC(C)(CNc1cc(-c2ccc(C)nc2)ncn1)c1ccccc1OC1CC1 |
| InChI | InChI=1S/C24H28N4O/c1-4-24(3,20-7-5-6-8-22(20)29-19-11-12-19)15-26-23-13-21(27-16-28-23)18-10-9-17(2)25-14-18/h5-10,13-14,16,19H,4,11-12,15H2,1-3H3,(H,26,27,28) |
| InChIKey | RWFHVPVYCBXOOQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |