C12H16FN — CID 123451765
N-(4-fluoro-2,6,7-trimethylocta-1,3,5,7-tetraen-3-yl)methanimine (PubChem CID 123451765) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is N-(4-fluoro-2,6,7-trimethylocta-1,3,5,7-tetraen-3-yl)methanimine.
| Compound Name | N-(4-fluoro-2,6,7-trimethylocta-1,3,5,7-tetraen-3-yl)methanimine |
|---|---|
| PubChem CID | 123451765 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(4-fluoro-2,6,7-trimethylocta-1,3,5,7-tetraen-3-yl)methanimine |
| SMILES | C=NC(C(=C)C)=C(F)C=C(C)C(=C)C |
| InChI | InChI=1S/C12H16FN/c1-8(2)10(5)7-11(13)12(14-6)9(3)4/h7H,1,3,6H2,2,4-5H3 |
| InChIKey | SVHAZLVIFVZEKL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|