C8H19N3 — CID 123452081
2,3,6,7-tetramethyl-1,2,4-triazepane (PubChem CID 123452081) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-1,2,4-triazepane.
| Compound Name | 2,3,6,7-tetramethyl-1,2,4-triazepane |
|---|---|
| PubChem CID | 123452081 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2,3,6,7-tetramethyl-1,2,4-triazepane |
| SMILES | CC1CNC(C)N(C)NC1C |
| InChI | InChI=1S/C8H19N3/c1-6-5-9-8(3)11(4)10-7(6)2/h6-10H,5H2,1-4H3 |
| InChIKey | AKOJLTCTYDYTDJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |