About 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene
2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene (PubChem CID 123452679) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene |
| PubChem CID | 123452679 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene |
| SMILES | CC=CC=C(C)CCc1ccc(C)cc1C |
| InChI | InChI=1S/C16H22/c1-5-6-7-13(2)8-10-16-11-9-14(3)12-15(16)4/h5-7,9,11-12H,8,10H2,1-4H3 |
| InChIKey | GYFFTIIGVBMETQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene?
The IUPAC name of 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene (CID 123452679) is 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene.
What is the SMILES notation for 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene?
The canonical SMILES for 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene is CC=CC=C(C)CCc1ccc(C)cc1C.
What is the InChIKey of 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene?
The InChIKey is GYFFTIIGVBMETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22/c1-5-6-7-13(2)8-10-16-11-9-14(3)12-15(16)4/h5-7,9,11-12H,8,10H2,1-4H3.
What are the key properties of 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene?
2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene has a molecular weight of 214.35 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-(3-methylhepta-3,5-dienyl)benzene is sourced from PubChem (CID 123452679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).