C9H17N3O — CID 123452711
N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 123452711) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 123452711 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | CNC(=O)N1CC2CCN(C)C2C1 |
| InChI | InChI=1S/C9H17N3O/c1-10-9(13)12-5-7-3-4-11(2)8(7)6-12/h7-8H,3-6H2,1-2H3,(H,10,13) |
| InChIKey | PVQJWDFYINKEGW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |