C25H24ClNO4 — CID 123452764
2-chloro-4-[4-cyclopropyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile (PubChem CID 123452764) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is 2-chloro-4-[4-cyclopropyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile.
| Compound Name | 2-chloro-4-[4-cyclopropyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 123452764 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-chloro-4-[4-cyclopropyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile |
| SMILES | CC1(C)OC(C)(C)C(=O)C(c2cc(Oc3ccc(C#N)c(Cl)c3)ccc2C2CC2)C1=O |
| InChI | InChI=1S/C25H24ClNO4/c1-24(2)22(28)21(23(29)25(3,4)31-24)19-11-16(9-10-18(19)14-5-6-14)30-17-8-7-15(13-27)20(26)12-17/h7-12,14,21H,5-6H2,1-4H3 |
| InChIKey | CMTUKVMPFBSDNW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|