C10H8N2O4 — CID 123452794
5,8-dioxo-7,9-dihydro-6H-pyrido[2,3-b]azepine-6-carboxylic acid (PubChem CID 123452794) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 5,8-dioxo-7,9-dihydro-6H-pyrido[2,3-b]azepine-6-carboxylic acid.
| Compound Name | 5,8-dioxo-7,9-dihydro-6H-pyrido[2,3-b]azepine-6-carboxylic acid |
|---|---|
| PubChem CID | 123452794 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5,8-dioxo-7,9-dihydro-6H-pyrido[2,3-b]azepine-6-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)C(=O)c2cccnc2N1 |
| InChI | InChI=1S/C10H8N2O4/c13-7-4-6(10(15)16)8(14)5-2-1-3-11-9(5)12-7/h1-3,6H,4H2,(H,15,16)(H,11,12,13) |
| InChIKey | HRXKLXMELXCBGZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|