C31H32N4O3S — CID 123452871
N-[6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[1-(6-hydroxynaphthalene-2-carbonyl)pyrrolidin-2-yl]benzamide (PubChem CID 123452871) has the molecular formula C31H32N4O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is N-[6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[1-(6-hydroxynaphthalene-2-carbonyl)pyrrolidin-2-yl]benzamide.
| Compound Name | N-[6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[1-(6-hydroxynaphthalene-2-carbonyl)pyrrolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 123452871 |
| Molecular Formula | C31H32N4O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | N-[6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[1-(6-hydroxynaphthalene-2-carbonyl)pyrrolidin-2-yl]benzamide |
| SMILES | CN(C)C1CCc2nc(NC(=O)c3cccc(C4CCCN4C(=O)c4ccc5cc(O)ccc5c4)c3)sc2C1 |
| InChI | InChI=1S/C31H32N4O3S/c1-34(2)24-11-13-26-28(18-24)39-31(32-26)33-29(37)22-6-3-5-21(16-22)27-7-4-14-35(27)30(38)23-9-8-20-17-25(36)12-10-19(20)15-23/h3,5-6,8-10,12,15-17,24,27,36H,4,7,11,13-14,18H2,1-2H3,(H,32,33,37) |
| InChIKey | QWXGUPIKXSSSSN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |