About 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol
3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol (PubChem CID 123452920) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol |
| PubChem CID | 123452920 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol |
| SMILES | CCCC(C)C(C)(C)C1OC1NC(C)(C)CCO |
| InChI | InChI=1S/C15H31NO2/c1-7-8-11(2)15(5,6)12-13(18-12)16-14(3,4)9-10-17/h11-13,16-17H,7-10H2,1-6H3 |
| InChIKey | KNBZELYXYISGFU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol?
The IUPAC name of 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol (CID 123452920) is 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol.
What is the SMILES notation for 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol?
The canonical SMILES for 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol is CCCC(C)C(C)(C)C1OC1NC(C)(C)CCO.
What is the InChIKey of 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol?
The InChIKey is KNBZELYXYISGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-7-8-11(2)15(5,6)12-13(18-12)16-14(3,4)9-10-17/h11-13,16-17H,7-10H2,1-6H3.
What are the key properties of 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol?
3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol has a molecular weight of 257.42 g/mol, XLogP of 2.92, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2,3-dimethylhexan-2-yl)oxiran-2-yl]amino]-3-methylbutan-1-ol is sourced from PubChem (CID 123452920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).