C9H15N — CID 123453305
(6Z)-4,5-dimethyl-2,3,4,5-tetrahydroazocine (PubChem CID 123453305) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (6Z)-4,5-dimethyl-2,3,4,5-tetrahydroazocine.
| Compound Name | (6Z)-4,5-dimethyl-2,3,4,5-tetrahydroazocine |
|---|---|
| PubChem CID | 123453305 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (6Z)-4,5-dimethyl-2,3,4,5-tetrahydroazocine |
| SMILES | CC1/C=C\C=N/CCC1C |
| InChI | InChI=1S/C9H15N/c1-8-4-3-6-10-7-5-9(8)2/h3-4,6,8-9H,5,7H2,1-2H3/b4-3-,10-6- |
| InChIKey | AMNKCUWZYZGDRH-YVCTXXAJSA-N |
| XLogP | 2.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |