C22H20S2Si2 — CID 123453446
3,3,14,14-tetramethyl-11,22-dithia-3,14-disilahexacyclo[10.10.0.02,10.04,9.013,21.015,20]docosa-1(12),2(10),4,6,8,13(21),15,17,19-nonaene (PubChem CID 123453446) has the molecular formula C22H20S2Si2 and a molecular weight of 404.71 g/mol. Its IUPAC name is 3,3,14,14-tetramethyl-11,22-dithia-3,14-disilahexacyclo[10.10.0.02,10.04,9.013,21.015,20]docosa-1(12),2(10),4,6,8,13(21),15,17,19-nonaene.
| Compound Name | 3,3,14,14-tetramethyl-11,22-dithia-3,14-disilahexacyclo[10.10.0.02,10.04,9.013,21.015,20]docosa-1(12),2(10),4,6,8,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 123453446 |
| Molecular Formula | C22H20S2Si2 |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 3,3,14,14-tetramethyl-11,22-dithia-3,14-disilahexacyclo[10.10.0.02,10.04,9.013,21.015,20]docosa-1(12),2(10),4,6,8,13(21),15,17,19-nonaene |
| SMILES | C[Si]1(C)c2ccccc2-c2sc3c4c(sc3c21)-c1ccccc1[Si]4(C)C |
| InChI | InChI=1S/C22H20S2Si2/c1-25(2)15-11-7-5-9-13(15)17-21(25)19-20(23-17)22-18(24-19)14-10-6-8-12-16(14)26(22,3)4/h5-12H,1-4H3 |
| InChIKey | HKUYGWGZZYOCCM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|