About methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal
methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal (PubChem CID 123453625) has the molecular formula C12H18OP3+
and a molecular weight of 271.20 g/mol. Its IUPAC name is methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal.
Molecular Properties
| Compound Name | methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal |
| PubChem CID | 123453625 |
| Molecular Formula | C12H18OP3+ |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal |
| SMILES | C/C=C/CC=O.C=[PH+]P(P)c1ccccc1 |
| InChI | InChI=1S/C7H9P3.C5H8O/c1-9-10(8)7-5-3-2-4-6-7;1-2-3-4-5-6/h2-6H,1,8H2;2-3,5H,4H2,1H3/p+1/b;3-2+ |
| InChIKey | TVBKULNDIALPNP-ZPYUXNTASA-O |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal?
The IUPAC name of methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal (CID 123453625) is methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal.
What is the SMILES notation for methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal?
The canonical SMILES for methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal is C/C=C/CC=O.C=[PH+]P(P)c1ccccc1.
What is the InChIKey of methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal?
The InChIKey is TVBKULNDIALPNP-ZPYUXNTASA-O. The full InChI is InChI=1S/C7H9P3.C5H8O/c1-9-10(8)7-5-3-2-4-6-7;1-2-3-4-5-6/h2-6H,1,8H2;2-3,5H,4H2,1H3/p+1/b;3-2+.
What are the key properties of methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal?
methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal has a molecular weight of 271.20 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-[phenyl(phosphanyl)phosphanyl]phosphanium;(E)-pent-3-enal is sourced from PubChem (CID 123453625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).