C15H24N6O — CID 123453736
3-[4-(hydroxymethyl)piperidin-1-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide (PubChem CID 123453736) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)piperidin-1-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide.
| Compound Name | 3-[4-(hydroxymethyl)piperidin-1-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide |
|---|---|
| PubChem CID | 123453736 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-[4-(hydroxymethyl)piperidin-1-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(/C=C/C)[nH]n1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C15H24N6O/c1-2-3-12-8-15(20-19-12)18-13(16)9-14(17)21-6-4-11(10-22)5-7-21/h2-3,8,11,17,22H,4-7,9-10H2,1H3,(H3,16,18,19,20)/b3-2+,17-14+ |
| InChIKey | ZNQGFSXBWUOTCO-ISJMYAIPSA-N |
| XLogP | 1.50 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|