C19H33BN2O2 — CID 123454503
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-N,1-N-bis(2-methylpropyl)benzene-1,2-diamine (PubChem CID 123454503) has the molecular formula C19H33BN2O2 and a molecular weight of 332.30 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-N,1-N-bis(2-methylpropyl)benzene-1,2-diamine.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-N,1-N-bis(2-methylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 123454503 |
| Molecular Formula | C19H33BN2O2 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-N,1-N-bis(2-methylpropyl)benzene-1,2-diamine |
| SMILES | CC(C)CN(CC(C)C)c1ccc(B2OCC(C)(C)CO2)cc1N |
| InChI | InChI=1S/C19H33BN2O2/c1-14(2)10-22(11-15(3)4)18-8-7-16(9-17(18)21)20-23-12-19(5,6)13-24-20/h7-9,14-15H,10-13,21H2,1-6H3 |
| InChIKey | UPQFAVKSMJMZEB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|