C16H20F3N4+ — CID 123454799
2,5-diethyl-8-(trifluoromethyl)-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),9,11,13-tetraene (PubChem CID 123454799) has the molecular formula C16H20F3N4+ and a molecular weight of 325.36 g/mol. Its IUPAC name is 2,5-diethyl-8-(trifluoromethyl)-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),9,11,13-tetraene.
| Compound Name | 2,5-diethyl-8-(trifluoromethyl)-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),9,11,13-tetraene |
|---|---|
| PubChem CID | 123454799 |
| Molecular Formula | C16H20F3N4+ |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2,5-diethyl-8-(trifluoromethyl)-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),9,11,13-tetraene |
| SMILES | CCC12CCC1(CC)[n+]1ccccc1C1=NC(C(F)(F)F)NN12 |
| InChI | InChI=1S/C16H20F3N4/c1-3-14-8-9-15(14,4-2)23-12(11-7-5-6-10-22(11)14)20-13(21-23)16(17,18)19/h5-7,10,13,21H,3-4,8-9H2,1-2H3/q+1 |
| InChIKey | SXPOMNSFSOFJQI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 31.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|