About 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one
7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one (PubChem CID 123455227) has the molecular formula C9H13FO2
and a molecular weight of 172.20 g/mol. Its IUPAC name is 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one.
Molecular Properties
| Compound Name | 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one |
| PubChem CID | 123455227 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one |
| SMILES | CC1C(=O)C(F)CC2(CO2)C1C |
| InChI | InChI=1S/C9H13FO2/c1-5-6(2)9(4-12-9)3-7(10)8(5)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZXYLTFIMXTUQMH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one?
The IUPAC name of 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one (CID 123455227) is 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one.
What is the SMILES notation for 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one?
The canonical SMILES for 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one is CC1C(=O)C(F)CC2(CO2)C1C.
What is the InChIKey of 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one?
The InChIKey is ZXYLTFIMXTUQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO2/c1-5-6(2)9(4-12-9)3-7(10)8(5)11/h5-7H,3-4H2,1-2H3.
What are the key properties of 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one?
7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one has a molecular weight of 172.20 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4,5-dimethyl-1-oxaspiro[2.5]octan-6-one is sourced from PubChem (CID 123455227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).