C17H24ClF2N5O3S — CID 123456365
6-chloro-5-diazenyl-N-[4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-2-propylsulfanylpyrimidin-4-amine (PubChem CID 123456365) has the molecular formula C17H24ClF2N5O3S and a molecular weight of 451.93 g/mol. Its IUPAC name is 6-chloro-5-diazenyl-N-[4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-2-propylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-diazenyl-N-[4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-2-propylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 123456365 |
| Molecular Formula | C17H24ClF2N5O3S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 6-chloro-5-diazenyl-N-[4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-2-propylsulfanylpyrimidin-4-amine |
| SMILES | [H]/N=N/c1c(Cl)nc(SCCC)nc1NC1CC(OCC(F)F)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C17H24ClF2N5O3S/c1-4-5-29-16-23-14(18)11(25-21)15(24-16)22-8-6-9(26-7-10(19)20)13-12(8)27-17(2,3)28-13/h8-10,12-13,21H,4-7H2,1-3H3,(H,22,23,24)/b25-21+ |
| InChIKey | XFINUZSSVGKLSV-NJNXFGOHSA-N |
| XLogP | 4.65 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|